C45H43N7O7 — CID 160671525
4-anilino-6-[4-[[7-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]-6-oxoheptyl]carbamoyl]-3-methylphenyl]-N-methylquinoline-3-carboxamide (PubChem CID 160671525) has the molecular formula C45H43N7O7 and a molecular weight of 793.88 g/mol. Its IUPAC name is 4-anilino-6-[4-[[7-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]-6-oxoheptyl]carbamoyl]-3-methylphenyl]-N-methylquinoline-3-carboxamide.
| Compound Name | 4-anilino-6-[4-[[7-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]-6-oxoheptyl]carbamoyl]-3-methylphenyl]-N-methylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 160671525 |
| Molecular Formula | C45H43N7O7 |
| Molecular Weight | 793.88 g/mol |
| Exact Mass | 793.32 |
| IUPAC Name | 4-anilino-6-[4-[[7-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]-6-oxoheptyl]carbamoyl]-3-methylphenyl]-N-methylquinoline-3-carboxamide |
| SMILES | CNC(=O)c1cnc2ccc(-c3ccc(C(=O)NCCCCCC(=O)CNc4cccc5c4C(=O)N(C4CCC(=O)NC4=O)C5=O)c(C)c3)cc2c1Nc1ccccc1 |
| InChI | InChI=1S/C45H43N7O7/c1-26-22-27(28-16-18-35-33(23-28)40(34(25-49-35)41(55)46-2)50-29-10-5-3-6-11-29)15-17-31(26)42(56)47-21-8-4-7-12-30(53)24-48-36-14-9-13-32-39(36)45(59)52(44(32)58)37-19-20-38(54)51-43(37)57/h3,5-6,9-11,13-18,22-23,25,37,48H,4,7-8,12,19-21,24H2,1-2H3,(H,46,55)(H,47,56)(H,49,50)(H,51,54,57) |
| InChIKey | TYAINEKAOKBZRR-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 195.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.88 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|