C28H39N5O7 — CID 167027588
2-(butan-2-ylamino)-6-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]-N-propan-2-ylhexanamide (PubChem CID 167027588) has the molecular formula C28H39N5O7 and a molecular weight of 557.65 g/mol. Its IUPAC name is 2-(butan-2-ylamino)-6-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]-N-propan-2-ylhexanamide.
| Compound Name | 2-(butan-2-ylamino)-6-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]-N-propan-2-ylhexanamide |
|---|---|
| PubChem CID | 167027588 |
| Molecular Formula | C28H39N5O7 |
| Molecular Weight | 557.65 g/mol |
| Exact Mass | 557.28 |
| IUPAC Name | 2-(butan-2-ylamino)-6-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]-N-propan-2-ylhexanamide |
| SMILES | CCC(C)NC(CCCCNC(=O)COc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O)C(=O)NC(C)C |
| InChI | InChI=1S/C28H39N5O7/c1-5-17(4)31-19(25(36)30-16(2)3)10-6-7-14-29-23(35)15-40-21-11-8-9-18-24(21)28(39)33(27(18)38)20-12-13-22(34)32-26(20)37/h8-9,11,16-17,19-20,31H,5-7,10,12-15H2,1-4H3,(H,29,35)(H,30,36)(H,32,34,37) |
| InChIKey | GUTZZQMDTOLPLR-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 163.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.65 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|