C23H23N5O2 — CID 167170583
N-[(8-hydroxy-5-methylquinolin-7-yl)-[3-(1,2,4-triazol-1-yl)phenyl]methyl]butanamide (PubChem CID 167170583) has the molecular formula C23H23N5O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is N-[(8-hydroxy-5-methylquinolin-7-yl)-[3-(1,2,4-triazol-1-yl)phenyl]methyl]butanamide.
| Compound Name | N-[(8-hydroxy-5-methylquinolin-7-yl)-[3-(1,2,4-triazol-1-yl)phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 167170583 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | N-[(8-hydroxy-5-methylquinolin-7-yl)-[3-(1,2,4-triazol-1-yl)phenyl]methyl]butanamide |
| SMILES | CCCC(=O)NC(c1cccc(-n2cncn2)c1)c1cc(C)c2cccnc2c1O |
| InChI | InChI=1S/C23H23N5O2/c1-3-6-20(29)27-21(16-7-4-8-17(12-16)28-14-24-13-26-28)19-11-15(2)18-9-5-10-25-22(18)23(19)30/h4-5,7-14,21,30H,3,6H2,1-2H3,(H,27,29) |
| InChIKey | AJRWBHPMMKPXCS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|