C22H21N3O4 — CID 164865668
N-[(8-hydroxy-5-methylquinolin-7-yl)-(2-oxo-3H-1,3-benzoxazol-6-yl)methyl]butanamide (PubChem CID 164865668) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is N-[(8-hydroxy-5-methylquinolin-7-yl)-(2-oxo-3H-1,3-benzoxazol-6-yl)methyl]butanamide.
| Compound Name | N-[(8-hydroxy-5-methylquinolin-7-yl)-(2-oxo-3H-1,3-benzoxazol-6-yl)methyl]butanamide |
|---|---|
| PubChem CID | 164865668 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | N-[(8-hydroxy-5-methylquinolin-7-yl)-(2-oxo-3H-1,3-benzoxazol-6-yl)methyl]butanamide |
| SMILES | CCCC(=O)NC(c1ccc2[nH]c(=O)oc2c1)c1cc(C)c2cccnc2c1O |
| InChI | InChI=1S/C22H21N3O4/c1-3-5-18(26)25-19(13-7-8-16-17(11-13)29-22(28)24-16)15-10-12(2)14-6-4-9-23-20(14)21(15)27/h4,6-11,19,27H,3,5H2,1-2H3,(H,24,28)(H,25,26) |
| InChIKey | PTSMPPBSYFZHIM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 108.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|