C20H24N2O5 — CID 162264033
2-(2,4-dioxocyclohexyl)-4-(6-hydroxyhexylamino)isoindole-1,3-dione (PubChem CID 162264033) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is 2-(2,4-dioxocyclohexyl)-4-(6-hydroxyhexylamino)isoindole-1,3-dione.
| Compound Name | 2-(2,4-dioxocyclohexyl)-4-(6-hydroxyhexylamino)isoindole-1,3-dione |
|---|---|
| PubChem CID | 162264033 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 2-(2,4-dioxocyclohexyl)-4-(6-hydroxyhexylamino)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NCCCCCCO)c3C2=O)C(=O)C1 |
| InChI | InChI=1S/C20H24N2O5/c23-11-4-2-1-3-10-21-15-7-5-6-14-18(15)20(27)22(19(14)26)16-9-8-13(24)12-17(16)25/h5-7,16,21,23H,1-4,8-12H2 |
| InChIKey | ZZQNMQIQFPLBTN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|