C30H33N3O5 — CID 149326479
2-(2,4-dioxocyclohexyl)-4-[[4-[(3-methoxy-8-azabicyclo[3.2.1]octan-8-yl)methyl]phenyl]methylamino]isoindole-1,3-dione (PubChem CID 149326479) has the molecular formula C30H33N3O5 and a molecular weight of 515.61 g/mol. Its IUPAC name is 2-(2,4-dioxocyclohexyl)-4-[[4-[(3-methoxy-8-azabicyclo[3.2.1]octan-8-yl)methyl]phenyl]methylamino]isoindole-1,3-dione.
| Compound Name | 2-(2,4-dioxocyclohexyl)-4-[[4-[(3-methoxy-8-azabicyclo[3.2.1]octan-8-yl)methyl]phenyl]methylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 149326479 |
| Molecular Formula | C30H33N3O5 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | 2-(2,4-dioxocyclohexyl)-4-[[4-[(3-methoxy-8-azabicyclo[3.2.1]octan-8-yl)methyl]phenyl]methylamino]isoindole-1,3-dione |
| SMILES | COC1CC2CCC(C1)N2Cc1ccc(CNc2cccc3c2C(=O)N(C2CCC(=O)CC2=O)C3=O)cc1 |
| InChI | InChI=1S/C30H33N3O5/c1-38-23-13-20-9-10-21(14-23)32(20)17-19-7-5-18(6-8-19)16-31-25-4-2-3-24-28(25)30(37)33(29(24)36)26-12-11-22(34)15-27(26)35/h2-8,20-21,23,26,31H,9-17H2,1H3 |
| InChIKey | YBLWKMHPQZWUGX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|