C32H30F3N5O4 — CID 158906408
2-(2,4-dioxocyclohexyl)-4-[[4-[[4-[6-(trifluoromethyl)-3-pyridinyl]piperazin-1-yl]methyl]phenyl]methylamino]isoindole-1,3-dione (PubChem CID 158906408) has the molecular formula C32H30F3N5O4 and a molecular weight of 605.62 g/mol. Its IUPAC name is 2-(2,4-dioxocyclohexyl)-4-[[4-[[4-[6-(trifluoromethyl)-3-pyridinyl]piperazin-1-yl]methyl]phenyl]methylamino]isoindole-1,3-dione.
| Compound Name | 2-(2,4-dioxocyclohexyl)-4-[[4-[[4-[6-(trifluoromethyl)-3-pyridinyl]piperazin-1-yl]methyl]phenyl]methylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 158906408 |
| Molecular Formula | C32H30F3N5O4 |
| Molecular Weight | 605.62 g/mol |
| Exact Mass | 605.22 |
| IUPAC Name | 2-(2,4-dioxocyclohexyl)-4-[[4-[[4-[6-(trifluoromethyl)-3-pyridinyl]piperazin-1-yl]methyl]phenyl]methylamino]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NCc4ccc(CN5CCN(c6ccc(C(F)(F)F)nc6)CC5)cc4)c3C2=O)C(=O)C1 |
| InChI | InChI=1S/C32H30F3N5O4/c33-32(34,35)28-11-8-22(18-37-28)39-14-12-38(13-15-39)19-21-6-4-20(5-7-21)17-36-25-3-1-2-24-29(25)31(44)40(30(24)43)26-10-9-23(41)16-27(26)42/h1-8,11,18,26,36H,9-10,12-17,19H2 |
| InChIKey | JGCDPFPCQTVDNW-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 102.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.62 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|