C32H28N4O4 — CID 158343689
3-[1-[[4-[[[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-4-yl]amino]methyl]phenyl]methyl]azetidin-3-yl]benzonitrile (PubChem CID 158343689) has the molecular formula C32H28N4O4 and a molecular weight of 532.60 g/mol. Its IUPAC name is 3-[1-[[4-[[[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-4-yl]amino]methyl]phenyl]methyl]azetidin-3-yl]benzonitrile.
| Compound Name | 3-[1-[[4-[[[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-4-yl]amino]methyl]phenyl]methyl]azetidin-3-yl]benzonitrile |
|---|---|
| PubChem CID | 158343689 |
| Molecular Formula | C32H28N4O4 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | 3-[1-[[4-[[[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-4-yl]amino]methyl]phenyl]methyl]azetidin-3-yl]benzonitrile |
| SMILES | N#Cc1cccc(C2CN(Cc3ccc(CNc4cccc5c4C(=O)N(C4CCC(=O)CC4=O)C5=O)cc3)C2)c1 |
| InChI | InChI=1S/C32H28N4O4/c33-15-22-3-1-4-23(13-22)24-18-35(19-24)17-21-9-7-20(8-10-21)16-34-27-6-2-5-26-30(27)32(40)36(31(26)39)28-12-11-25(37)14-29(28)38/h1-10,13,24,28,34H,11-12,14,16-19H2 |
| InChIKey | GRLSYOLKQDDOCW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 110.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|