C31H32N6O5 — CID 160991539
2-(2,4-dioxocyclohexyl)-4-[[4-[[4-(6-methoxypyrimidin-4-yl)piperazin-1-yl]methyl]phenyl]methylamino]isoindole-1,3-dione (PubChem CID 160991539) has the molecular formula C31H32N6O5 and a molecular weight of 568.63 g/mol. Its IUPAC name is 2-(2,4-dioxocyclohexyl)-4-[[4-[[4-(6-methoxypyrimidin-4-yl)piperazin-1-yl]methyl]phenyl]methylamino]isoindole-1,3-dione.
| Compound Name | 2-(2,4-dioxocyclohexyl)-4-[[4-[[4-(6-methoxypyrimidin-4-yl)piperazin-1-yl]methyl]phenyl]methylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 160991539 |
| Molecular Formula | C31H32N6O5 |
| Molecular Weight | 568.63 g/mol |
| Exact Mass | 568.24 |
| IUPAC Name | 2-(2,4-dioxocyclohexyl)-4-[[4-[[4-(6-methoxypyrimidin-4-yl)piperazin-1-yl]methyl]phenyl]methylamino]isoindole-1,3-dione |
| SMILES | COc1cc(N2CCN(Cc3ccc(CNc4cccc5c4C(=O)N(C4CCC(=O)CC4=O)C5=O)cc3)CC2)ncn1 |
| InChI | InChI=1S/C31H32N6O5/c1-42-28-16-27(33-19-34-28)36-13-11-35(12-14-36)18-21-7-5-20(6-8-21)17-32-24-4-2-3-23-29(24)31(41)37(30(23)40)25-10-9-22(38)15-26(25)39/h2-8,16,19,25,32H,9-15,17-18H2,1H3 |
| InChIKey | TURQFSJKJAIPNY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.63 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|