C16H15NO5 — CID 162711688
2-(2,4-dioxocyclohexyl)-4-ethoxyisoindole-1,3-dione (PubChem CID 162711688) has the molecular formula C16H15NO5 and a molecular weight of 301.30 g/mol. Its IUPAC name is 2-(2,4-dioxocyclohexyl)-4-ethoxyisoindole-1,3-dione.
| Compound Name | 2-(2,4-dioxocyclohexyl)-4-ethoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 162711688 |
| Molecular Formula | C16H15NO5 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 2-(2,4-dioxocyclohexyl)-4-ethoxyisoindole-1,3-dione |
| SMILES | CCOc1cccc2c1C(=O)N(C1CCC(=O)CC1=O)C2=O |
| InChI | InChI=1S/C16H15NO5/c1-2-22-13-5-3-4-10-14(13)16(21)17(15(10)20)11-7-6-9(18)8-12(11)19/h3-5,11H,2,6-8H2,1H3 |
| InChIKey | LZFWCROFEIVENC-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|