C14H10N2O6 — CID 159665010
2-(2,4-dioxocyclohexyl)-4-nitroisoindole-1,3-dione (PubChem CID 159665010) has the molecular formula C14H10N2O6 and a molecular weight of 302.24 g/mol. Its IUPAC name is 2-(2,4-dioxocyclohexyl)-4-nitroisoindole-1,3-dione.
| Compound Name | 2-(2,4-dioxocyclohexyl)-4-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 159665010 |
| Molecular Formula | C14H10N2O6 |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 2-(2,4-dioxocyclohexyl)-4-nitroisoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc([N+](=O)[O-])c3C2=O)C(=O)C1 |
| InChI | InChI=1S/C14H10N2O6/c17-7-4-5-9(11(18)6-7)15-13(19)8-2-1-3-10(16(21)22)12(8)14(15)20/h1-3,9H,4-6H2 |
| InChIKey | IUHGFMHYNNOZIU-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 114.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|