C13H9N3O6 — CID 20581734
2-[(3R)-2,6-dioxopiperidin-3-yl]-4-nitroisoindole-1,3-dione (PubChem CID 20581734) has the molecular formula C13H9N3O6 and a molecular weight of 303.23 g/mol. Its IUPAC name is 2-[(3R)-2,6-dioxopiperidin-3-yl]-4-nitroisoindole-1,3-dione.
| Compound Name | 2-[(3R)-2,6-dioxopiperidin-3-yl]-4-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 20581734 |
| Molecular Formula | C13H9N3O6 |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 2-[(3R)-2,6-dioxopiperidin-3-yl]-4-nitroisoindole-1,3-dione |
| SMILES | O=C1CC[C@@H](N2C(=O)c3cccc([N+](=O)[O-])c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C13H9N3O6/c17-9-5-4-8(11(18)14-9)15-12(19)6-2-1-3-7(16(21)22)10(6)13(15)20/h1-3,8H,4-5H2,(H,14,17,18)/t8-/m1/s1 |
| InChIKey | KVRCAGKHAZRSQX-MRVPVSSYSA-N |
| XLogP | -0.00 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|