C15H14N2O5 — CID 149005711
4-nitro-2-[(1R)-2-oxocycloheptyl]isoindole-1,3-dione (PubChem CID 149005711) has the molecular formula C15H14N2O5 and a molecular weight of 302.29 g/mol. Its IUPAC name is 4-nitro-2-[(1R)-2-oxocycloheptyl]isoindole-1,3-dione.
| Compound Name | 4-nitro-2-[(1R)-2-oxocycloheptyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 149005711 |
| Molecular Formula | C15H14N2O5 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 4-nitro-2-[(1R)-2-oxocycloheptyl]isoindole-1,3-dione |
| SMILES | O=C1CCCCC[C@H]1N1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C15H14N2O5/c18-12-8-3-1-2-6-10(12)16-14(19)9-5-4-7-11(17(21)22)13(9)15(16)20/h4-5,7,10H,1-3,6,8H2/t10-/m1/s1 |
| InChIKey | QANIOZBYNXRHSJ-SNVBAGLBSA-N |
| XLogP | 2.09 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|