C13H13N3O6 — CID 151015971
2-(2,6-dihydroxypiperidin-3-yl)-4-nitroisoindole-1,3-dione (PubChem CID 151015971) has the molecular formula C13H13N3O6 and a molecular weight of 307.26 g/mol. Its IUPAC name is 2-(2,6-dihydroxypiperidin-3-yl)-4-nitroisoindole-1,3-dione.
| Compound Name | 2-(2,6-dihydroxypiperidin-3-yl)-4-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 151015971 |
| Molecular Formula | C13H13N3O6 |
| Molecular Weight | 307.26 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 2-(2,6-dihydroxypiperidin-3-yl)-4-nitroisoindole-1,3-dione |
| SMILES | O=C1c2cccc([N+](=O)[O-])c2C(=O)N1C1CCC(O)NC1O |
| InChI | InChI=1S/C13H13N3O6/c17-9-5-4-8(11(18)14-9)15-12(19)6-2-1-3-7(16(21)22)10(6)13(15)20/h1-3,8-9,11,14,17-18H,4-5H2 |
| InChIKey | LXBULEOJQROIKL-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 133.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.26 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|