C11H10N2O6 — CID 78912076
2-(2,3-dihydroxypropyl)-4-nitroisoindole-1,3-dione (PubChem CID 78912076) has the molecular formula C11H10N2O6 and a molecular weight of 266.21 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropyl)-4-nitroisoindole-1,3-dione.
| Compound Name | 2-(2,3-dihydroxypropyl)-4-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 78912076 |
| Molecular Formula | C11H10N2O6 |
| Molecular Weight | 266.21 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 2-(2,3-dihydroxypropyl)-4-nitroisoindole-1,3-dione |
| SMILES | O=C1c2cccc([N+](=O)[O-])c2C(=O)N1CC(O)CO |
| InChI | InChI=1S/C11H10N2O6/c14-5-6(15)4-12-10(16)7-2-1-3-8(13(18)19)9(7)11(12)17/h1-3,6,14-15H,4-5H2 |
| InChIKey | WSZBDWHWKQGSLV-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 120.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.21 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|