C14H14N2O4 — CID 122210343
2-(2,3-dimethylbut-2-enyl)-4-nitroisoindole-1,3-dione (PubChem CID 122210343) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 2-(2,3-dimethylbut-2-enyl)-4-nitroisoindole-1,3-dione.
| Compound Name | 2-(2,3-dimethylbut-2-enyl)-4-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 122210343 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 2-(2,3-dimethylbut-2-enyl)-4-nitroisoindole-1,3-dione |
| SMILES | CC(C)=C(C)CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C14H14N2O4/c1-8(2)9(3)7-15-13(17)10-5-4-6-11(16(19)20)12(10)14(15)18/h4-6H,7H2,1-3H3 |
| InChIKey | KXTKJJQDMZXFHD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|