C11H11N3O5 — CID 18070718
2-(3-amino-2-hydroxypropyl)-4-nitroisoindole-1,3-dione (PubChem CID 18070718) has the molecular formula C11H11N3O5 and a molecular weight of 265.22 g/mol. Its IUPAC name is 2-(3-amino-2-hydroxypropyl)-4-nitroisoindole-1,3-dione.
| Compound Name | 2-(3-amino-2-hydroxypropyl)-4-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 18070718 |
| Molecular Formula | C11H11N3O5 |
| Molecular Weight | 265.22 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 2-(3-amino-2-hydroxypropyl)-4-nitroisoindole-1,3-dione |
| SMILES | NCC(O)CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C11H11N3O5/c12-4-6(15)5-13-10(16)7-2-1-3-8(14(18)19)9(7)11(13)17/h1-3,6,15H,4-5,12H2 |
| InChIKey | YTSVILVXVDDFRT-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 126.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.22 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|