C18H14N4O6 — CID 55504954
2-[[2-(4-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]-2-phenylacetamide (PubChem CID 55504954) has the molecular formula C18H14N4O6 and a molecular weight of 382.33 g/mol. Its IUPAC name is 2-[[2-(4-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]-2-phenylacetamide.
| Compound Name | 2-[[2-(4-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]-2-phenylacetamide |
|---|---|
| PubChem CID | 55504954 |
| Molecular Formula | C18H14N4O6 |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 2-[[2-(4-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]-2-phenylacetamide |
| SMILES | NC(=O)C(NC(=O)CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)c1ccccc1 |
| InChI | InChI=1S/C18H14N4O6/c19-16(24)15(10-5-2-1-3-6-10)20-13(23)9-21-17(25)11-7-4-8-12(22(27)28)14(11)18(21)26/h1-8,15H,9H2,(H2,19,24)(H,20,23) |
| InChIKey | KRJMHMVSYIXPQJ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 152.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|