C24H15F2N3O5 — CID 15991908
2-[1-(3-fluoro-4-methylphenyl)-2-(4-fluorophenyl)-4-oxoazetidin-3-yl]-4-nitroisoindole-1,3-dione (PubChem CID 15991908) has the molecular formula C24H15F2N3O5 and a molecular weight of 463.40 g/mol. Its IUPAC name is 2-[1-(3-fluoro-4-methylphenyl)-2-(4-fluorophenyl)-4-oxoazetidin-3-yl]-4-nitroisoindole-1,3-dione.
| Compound Name | 2-[1-(3-fluoro-4-methylphenyl)-2-(4-fluorophenyl)-4-oxoazetidin-3-yl]-4-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 15991908 |
| Molecular Formula | C24H15F2N3O5 |
| Molecular Weight | 463.40 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | 2-[1-(3-fluoro-4-methylphenyl)-2-(4-fluorophenyl)-4-oxoazetidin-3-yl]-4-nitroisoindole-1,3-dione |
| SMILES | Cc1ccc(N2C(=O)C(N3C(=O)c4cccc([N+](=O)[O-])c4C3=O)C2c2ccc(F)cc2)cc1F |
| InChI | InChI=1S/C24H15F2N3O5/c1-12-5-10-15(11-17(12)26)27-20(13-6-8-14(25)9-7-13)21(24(27)32)28-22(30)16-3-2-4-18(29(33)34)19(16)23(28)31/h2-11,20-21H,1H3 |
| InChIKey | NRQHWIVQEWKYHJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|