C22H21N3O5 — CID 7563635
N-cyclohexyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-phenylacetamide (PubChem CID 7563635) has the molecular formula C22H21N3O5 and a molecular weight of 407.43 g/mol. Its IUPAC name is N-cyclohexyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-phenylacetamide.
| Compound Name | N-cyclohexyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-phenylacetamide |
|---|---|
| PubChem CID | 7563635 |
| Molecular Formula | C22H21N3O5 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | N-cyclohexyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-phenylacetamide |
| SMILES | O=C1c2cccc([N+](=O)[O-])c2C(=O)N1CC(=O)N(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C22H21N3O5/c26-19(24(15-8-3-1-4-9-15)16-10-5-2-6-11-16)14-23-21(27)17-12-7-13-18(25(29)30)20(17)22(23)28/h1,3-4,7-9,12-13,16H,2,5-6,10-11,14H2 |
| InChIKey | ROLIFWUDLYTQMT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|