C17H16F3N3O5 — CID 7233500
N-[(1R)-1-cyclopropylethyl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 7233500) has the molecular formula C17H16F3N3O5 and a molecular weight of 399.33 g/mol. Its IUPAC name is N-[(1R)-1-cyclopropylethyl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | N-[(1R)-1-cyclopropylethyl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 7233500 |
| Molecular Formula | C17H16F3N3O5 |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | N-[(1R)-1-cyclopropylethyl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | C[C@H](C1CC1)N(CC(F)(F)F)C(=O)CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C17H16F3N3O5/c1-9(10-5-6-10)22(8-17(18,19)20)13(24)7-21-15(25)11-3-2-4-12(23(27)28)14(11)16(21)26/h2-4,9-10H,5-8H2,1H3/t9-/m1/s1 |
| InChIKey | GNBASQRWNSOUEY-SECBINFHSA-N |
| XLogP | 2.38 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|