C15H15F3N4O5 — CID 55861593
N,N-dimethyl-2-[(4-nitro-1,3-dioxoisoindol-2-yl)methyl-(2,2,2-trifluoroethyl)amino]acetamide (PubChem CID 55861593) has the molecular formula C15H15F3N4O5 and a molecular weight of 388.30 g/mol. Its IUPAC name is N,N-dimethyl-2-[(4-nitro-1,3-dioxoisoindol-2-yl)methyl-(2,2,2-trifluoroethyl)amino]acetamide.
| Compound Name | N,N-dimethyl-2-[(4-nitro-1,3-dioxoisoindol-2-yl)methyl-(2,2,2-trifluoroethyl)amino]acetamide |
|---|---|
| PubChem CID | 55861593 |
| Molecular Formula | C15H15F3N4O5 |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | N,N-dimethyl-2-[(4-nitro-1,3-dioxoisoindol-2-yl)methyl-(2,2,2-trifluoroethyl)amino]acetamide |
| SMILES | CN(C)C(=O)CN(CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)CC(F)(F)F |
| InChI | InChI=1S/C15H15F3N4O5/c1-19(2)11(23)6-20(7-15(16,17)18)8-21-13(24)9-4-3-5-10(22(26)27)12(9)14(21)25/h3-5H,6-8H2,1-2H3 |
| InChIKey | VMJBTSRCUIZWCA-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 104.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|