C19H15N3O5 — CID 26202111
N-[(1R)-2,3-dihydro-1H-inden-1-yl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 26202111) has the molecular formula C19H15N3O5 and a molecular weight of 365.35 g/mol. Its IUPAC name is N-[(1R)-2,3-dihydro-1H-inden-1-yl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-[(1R)-2,3-dihydro-1H-inden-1-yl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 26202111 |
| Molecular Formula | C19H15N3O5 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | N-[(1R)-2,3-dihydro-1H-inden-1-yl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | O=C(CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)N[C@@H]1CCc2ccccc21 |
| InChI | InChI=1S/C19H15N3O5/c23-16(20-14-9-8-11-4-1-2-5-12(11)14)10-21-18(24)13-6-3-7-15(22(26)27)17(13)19(21)25/h1-7,14H,8-10H2,(H,20,23)/t14-/m1/s1 |
| InChIKey | RWTPZFBAIXOQRT-CQSZACIVSA-N |
| XLogP | 1.99 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|