C16H12N2O4 — CID 146410790
2-(2,6-dioxopiperidin-3-yl)-4-prop-1-ynylisoindole-1,3-dione (PubChem CID 146410790) has the molecular formula C16H12N2O4 and a molecular weight of 296.28 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-prop-1-ynylisoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-prop-1-ynylisoindole-1,3-dione |
|---|---|
| PubChem CID | 146410790 |
| Molecular Formula | C16H12N2O4 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-prop-1-ynylisoindole-1,3-dione |
| SMILES | CC#Cc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C16H12N2O4/c1-2-4-9-5-3-6-10-13(9)16(22)18(15(10)21)11-7-8-12(19)17-14(11)20/h3,5-6,11H,7-8H2,1H3,(H,17,19,20) |
| InChIKey | CJGUMYBCXNBFHR-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|