C21H25NO4 — CID 157384519
2-(2,4-dioxocyclohexyl)-4-heptylisoindole-1,3-dione (PubChem CID 157384519) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is 2-(2,4-dioxocyclohexyl)-4-heptylisoindole-1,3-dione.
| Compound Name | 2-(2,4-dioxocyclohexyl)-4-heptylisoindole-1,3-dione |
|---|---|
| PubChem CID | 157384519 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 2-(2,4-dioxocyclohexyl)-4-heptylisoindole-1,3-dione |
| SMILES | CCCCCCCc1cccc2c1C(=O)N(C1CCC(=O)CC1=O)C2=O |
| InChI | InChI=1S/C21H25NO4/c1-2-3-4-5-6-8-14-9-7-10-16-19(14)21(26)22(20(16)25)17-12-11-15(23)13-18(17)24/h7,9-10,17H,2-6,8,11-13H2,1H3 |
| InChIKey | ZUFGQAOYTODKMH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|