C29H29N3O4 — CID 161039594
2-(2,4-dioxocyclohexyl)-4-[2-[1-[(6-ethynyl-3-pyridinyl)methyl]piperidin-4-yl]ethyl]isoindole-1,3-dione (PubChem CID 161039594) has the molecular formula C29H29N3O4 and a molecular weight of 483.57 g/mol. Its IUPAC name is 2-(2,4-dioxocyclohexyl)-4-[2-[1-[(6-ethynyl-3-pyridinyl)methyl]piperidin-4-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-(2,4-dioxocyclohexyl)-4-[2-[1-[(6-ethynyl-3-pyridinyl)methyl]piperidin-4-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 161039594 |
| Molecular Formula | C29H29N3O4 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 2-(2,4-dioxocyclohexyl)-4-[2-[1-[(6-ethynyl-3-pyridinyl)methyl]piperidin-4-yl]ethyl]isoindole-1,3-dione |
| SMILES | C#Cc1ccc(CN2CCC(CCc3cccc4c3C(=O)N(C3CCC(=O)CC3=O)C4=O)CC2)cn1 |
| InChI | InChI=1S/C29H29N3O4/c1-2-22-9-7-20(17-30-22)18-31-14-12-19(13-15-31)6-8-21-4-3-5-24-27(21)29(36)32(28(24)35)25-11-10-23(33)16-26(25)34/h1,3-5,7,9,17,19,25H,6,8,10-16,18H2 |
| InChIKey | UASCPPHYKWCKOP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|