C25H18F6N2O5 — CID 58307267
2-[3,5-bis(trifluoromethyl)phenyl]-N-[[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-4-yl]methyl]acetamide (PubChem CID 58307267) has the molecular formula C25H18F6N2O5 and a molecular weight of 540.42 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-N-[[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-4-yl]methyl]acetamide.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-N-[[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 58307267 |
| Molecular Formula | C25H18F6N2O5 |
| Molecular Weight | 540.42 g/mol |
| Exact Mass | 540.11 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-N-[[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-4-yl]methyl]acetamide |
| SMILES | O=C1CCC(N2C(=O)c3cccc(CNC(=O)Cc4cc(C(F)(F)F)cc(C(F)(F)F)c4)c3C2=O)C(=O)C1 |
| InChI | InChI=1S/C25H18F6N2O5/c26-24(27,28)14-6-12(7-15(9-14)25(29,30)31)8-20(36)32-11-13-2-1-3-17-21(13)23(38)33(22(17)37)18-5-4-16(34)10-19(18)35/h1-3,6-7,9,18H,4-5,8,10-11H2,(H,32,36) |
| InChIKey | MOPIXAFLPKQTMI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|