C27H25N3O5 — CID 163967404
N-[[2-(2,5-dioxocycloheptyl)-1,3-dioxoisoindol-4-yl]methyl]-2-(1-methylindol-3-yl)acetamide (PubChem CID 163967404) has the molecular formula C27H25N3O5 and a molecular weight of 471.51 g/mol. Its IUPAC name is N-[[2-(2,5-dioxocycloheptyl)-1,3-dioxoisoindol-4-yl]methyl]-2-(1-methylindol-3-yl)acetamide.
| Compound Name | N-[[2-(2,5-dioxocycloheptyl)-1,3-dioxoisoindol-4-yl]methyl]-2-(1-methylindol-3-yl)acetamide |
|---|---|
| PubChem CID | 163967404 |
| Molecular Formula | C27H25N3O5 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | N-[[2-(2,5-dioxocycloheptyl)-1,3-dioxoisoindol-4-yl]methyl]-2-(1-methylindol-3-yl)acetamide |
| SMILES | Cn1cc(CC(=O)NCc2cccc3c2C(=O)N(C2CCC(=O)CCC2=O)C3=O)c2ccccc21 |
| InChI | InChI=1S/C27H25N3O5/c1-29-15-17(19-6-2-3-8-21(19)29)13-24(33)28-14-16-5-4-7-20-25(16)27(35)30(26(20)34)22-11-9-18(31)10-12-23(22)32/h2-8,15,22H,9-14H2,1H3,(H,28,33) |
| InChIKey | SMZWGFZIVIZMOL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|