C20H24N4O4 — CID 21040121
1,1-diethyl-3-[[2-(6-methylidene-2-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methyl]urea (PubChem CID 21040121) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is 1,1-diethyl-3-[[2-(6-methylidene-2-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methyl]urea.
| Compound Name | 1,1-diethyl-3-[[2-(6-methylidene-2-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methyl]urea |
|---|---|
| PubChem CID | 21040121 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 1,1-diethyl-3-[[2-(6-methylidene-2-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methyl]urea |
| SMILES | C=C1CCC(N2C(=O)c3cccc(CNC(=O)N(CC)CC)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C20H24N4O4/c1-4-23(5-2)20(28)21-11-13-7-6-8-14-16(13)19(27)24(18(14)26)15-10-9-12(3)22-17(15)25/h6-8,15H,3-5,9-11H2,1-2H3,(H,21,28)(H,22,25) |
| InChIKey | PLODZUYWDLTQAR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|