C17H16N2O4 — CID 145256106
3-[2-(6-methylidene-2-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propanal (PubChem CID 145256106) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is 3-[2-(6-methylidene-2-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propanal.
| Compound Name | 3-[2-(6-methylidene-2-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propanal |
|---|---|
| PubChem CID | 145256106 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 3-[2-(6-methylidene-2-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propanal |
| SMILES | C=C1CCC(N2C(=O)c3cccc(CCC=O)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C17H16N2O4/c1-10-7-8-13(15(21)18-10)19-16(22)12-6-2-4-11(5-3-9-20)14(12)17(19)23/h2,4,6,9,13H,1,3,5,7-8H2,(H,18,21) |
| InChIKey | QLRXWNOPTLKYGL-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|