C17H17N3O3 — CID 177002953
4-(azetidin-1-yl)-2-(6-methylidene-2-oxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 177002953) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is 4-(azetidin-1-yl)-2-(6-methylidene-2-oxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-(azetidin-1-yl)-2-(6-methylidene-2-oxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 177002953 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 4-(azetidin-1-yl)-2-(6-methylidene-2-oxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | C=C1CCC(N2C(=O)c3cccc(N4CCC4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C17H17N3O3/c1-10-6-7-13(15(21)18-10)20-16(22)11-4-2-5-12(14(11)17(20)23)19-8-3-9-19/h2,4-5,13H,1,3,6-9H2,(H,18,21) |
| InChIKey | BRRRBTSIYABBTL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|