C23H26N4O5 — CID 167431824
2-(2,6-dioxopiperidin-3-yl)-4-[4-(pyrrolidine-1-carbonyl)piperidin-1-yl]isoindole-1,3-dione (PubChem CID 167431824) has the molecular formula C23H26N4O5 and a molecular weight of 438.48 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[4-(pyrrolidine-1-carbonyl)piperidin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[4-(pyrrolidine-1-carbonyl)piperidin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167431824 |
| Molecular Formula | C23H26N4O5 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[4-(pyrrolidine-1-carbonyl)piperidin-1-yl]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(N4CCC(C(=O)N5CCCC5)CC4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H26N4O5/c28-18-7-6-17(20(29)24-18)27-22(31)15-4-3-5-16(19(15)23(27)32)25-12-8-14(9-13-25)21(30)26-10-1-2-11-26/h3-5,14,17H,1-2,6-13H2,(H,24,28,29) |
| InChIKey | TVVVSJPLJGOQNN-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|