C24H30N6O5 — CID 167462616
4-[4-[2-[(3R)-3-aminopiperidin-1-yl]-2-oxoethyl]piperazin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 167462616) has the molecular formula C24H30N6O5 and a molecular weight of 482.54 g/mol. Its IUPAC name is 4-[4-[2-[(3R)-3-aminopiperidin-1-yl]-2-oxoethyl]piperazin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[4-[2-[(3R)-3-aminopiperidin-1-yl]-2-oxoethyl]piperazin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167462616 |
| Molecular Formula | C24H30N6O5 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | 4-[4-[2-[(3R)-3-aminopiperidin-1-yl]-2-oxoethyl]piperazin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | N[C@@H]1CCCN(C(=O)CN2CCN(c3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4=O)CC2)C1 |
| InChI | InChI=1S/C24H30N6O5/c25-15-3-2-8-29(13-15)20(32)14-27-9-11-28(12-10-27)17-5-1-4-16-21(17)24(35)30(23(16)34)18-6-7-19(31)26-22(18)33/h1,4-5,15,18H,2-3,6-14,25H2,(H,26,31,33)/t15-,18?/m1/s1 |
| InChIKey | ONLYCAFSWVAJKO-NNJIEVJOSA-N |
| XLogP | -0.84 |
| TPSA | 136.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|