C25H28N4O7 — CID 162482451
1-[2-[(3R)-1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]piperidin-3-yl]acetyl]pyrrolidine-3-carboxylic acid (PubChem CID 162482451) has the molecular formula C25H28N4O7 and a molecular weight of 496.52 g/mol. Its IUPAC name is 1-[2-[(3R)-1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]piperidin-3-yl]acetyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[2-[(3R)-1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]piperidin-3-yl]acetyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 162482451 |
| Molecular Formula | C25H28N4O7 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | 1-[2-[(3R)-1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]piperidin-3-yl]acetyl]pyrrolidine-3-carboxylic acid |
| SMILES | O=C1CCC(N2C(=O)c3cccc(N4CCC[C@H](CC(=O)N5CCC(C(=O)O)C5)C4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H28N4O7/c30-19-7-6-18(22(32)26-19)29-23(33)16-4-1-5-17(21(16)24(29)34)27-9-2-3-14(12-27)11-20(31)28-10-8-15(13-28)25(35)36/h1,4-5,14-15,18H,2-3,6-13H2,(H,35,36)(H,26,30,32)/t14-,15?,18?/m1/s1 |
| InChIKey | VZFXBDOHAXIPAL-KSTDHSDQSA-N |
| XLogP | 0.63 |
| TPSA | 144.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|