C23H27N5O6 — CID 167462623
4-[3-[2-(4-aminopiperidin-1-yl)-2-oxoethoxy]azetidin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 167462623) has the molecular formula C23H27N5O6 and a molecular weight of 469.50 g/mol. Its IUPAC name is 4-[3-[2-(4-aminopiperidin-1-yl)-2-oxoethoxy]azetidin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[3-[2-(4-aminopiperidin-1-yl)-2-oxoethoxy]azetidin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167462623 |
| Molecular Formula | C23H27N5O6 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 4-[3-[2-(4-aminopiperidin-1-yl)-2-oxoethoxy]azetidin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | NC1CCN(C(=O)COC2CN(c3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4=O)C2)CC1 |
| InChI | InChI=1S/C23H27N5O6/c24-13-6-8-26(9-7-13)19(30)12-34-14-10-27(11-14)16-3-1-2-15-20(16)23(33)28(22(15)32)17-4-5-18(29)25-21(17)31/h1-3,13-14,17H,4-12,24H2,(H,25,29,31) |
| InChIKey | OORFLUZLQBWDPO-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 142.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|