C27H36N6O6 — CID 167463016
4-[2-[2-[4-(4-aminocyclohexyl)piperazin-1-yl]-2-oxoethoxy]ethylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 167463016) has the molecular formula C27H36N6O6 and a molecular weight of 540.62 g/mol. Its IUPAC name is 4-[2-[2-[4-(4-aminocyclohexyl)piperazin-1-yl]-2-oxoethoxy]ethylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[2-[2-[4-(4-aminocyclohexyl)piperazin-1-yl]-2-oxoethoxy]ethylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167463016 |
| Molecular Formula | C27H36N6O6 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | 4-[2-[2-[4-(4-aminocyclohexyl)piperazin-1-yl]-2-oxoethoxy]ethylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | NC1CCC(N2CCN(C(=O)COCCNc3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4=O)CC2)CC1 |
| InChI | InChI=1S/C27H36N6O6/c28-17-4-6-18(7-5-17)31-11-13-32(14-12-31)23(35)16-39-15-10-29-20-3-1-2-19-24(20)27(38)33(26(19)37)21-8-9-22(34)30-25(21)36/h1-3,17-18,21,29H,4-16,28H2,(H,30,34,36) |
| InChIKey | TYTXRABPONTGGT-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 154.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|