C19H25Cl2N5O4 — CID 166428474
4-[4-(2-aminoethyl)piperazin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;dihydrochloride (PubChem CID 166428474) has the molecular formula C19H25Cl2N5O4 and a molecular weight of 458.35 g/mol. Its IUPAC name is 4-[4-(2-aminoethyl)piperazin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;dihydrochloride.
| Compound Name | 4-[4-(2-aminoethyl)piperazin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;dihydrochloride |
|---|---|
| PubChem CID | 166428474 |
| Molecular Formula | C19H25Cl2N5O4 |
| Molecular Weight | 458.35 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 4-[4-(2-aminoethyl)piperazin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;dihydrochloride |
| SMILES | Cl.Cl.NCCN1CCN(c2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C19H23N5O4.2ClH/c20-6-7-22-8-10-23(11-9-22)13-3-1-2-12-16(13)19(28)24(18(12)27)14-4-5-15(25)21-17(14)26;;/h1-3,14H,4-11,20H2,(H,21,25,26);2*1H |
| InChIKey | JOSHHPUFELMORN-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 116.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.35 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|