C24H31N5O6 — CID 175986980
[5-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]piperazin-1-yl]-2-methylpentan-2-yl] carbamate (PubChem CID 175986980) has the molecular formula C24H31N5O6 and a molecular weight of 485.54 g/mol. Its IUPAC name is [5-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]piperazin-1-yl]-2-methylpentan-2-yl] carbamate.
| Compound Name | [5-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]piperazin-1-yl]-2-methylpentan-2-yl] carbamate |
|---|---|
| PubChem CID | 175986980 |
| Molecular Formula | C24H31N5O6 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | [5-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]piperazin-1-yl]-2-methylpentan-2-yl] carbamate |
| SMILES | CC(C)(CCCN1CCN(c2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)CC1)OC(N)=O |
| InChI | InChI=1S/C24H31N5O6/c1-24(2,35-23(25)34)9-4-10-27-11-13-28(14-12-27)16-6-3-5-15-19(16)22(33)29(21(15)32)17-7-8-18(30)26-20(17)31/h3,5-6,17H,4,7-14H2,1-2H3,(H2,25,34)(H,26,30,31) |
| InChIKey | JREJAVXNVUNVRA-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 142.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|