C15H14N2O3 — CID 145202026
4-methyl-2-(6-methylidene-2-oxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 145202026) has the molecular formula C15H14N2O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is 4-methyl-2-(6-methylidene-2-oxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-methyl-2-(6-methylidene-2-oxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 145202026 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 4-methyl-2-(6-methylidene-2-oxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | C=C1CCC(N2C(=O)c3cccc(C)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C15H14N2O3/c1-8-4-3-5-10-12(8)15(20)17(14(10)19)11-7-6-9(2)16-13(11)18/h3-5,11H,2,6-7H2,1H3,(H,16,18) |
| InChIKey | UISQYFBMDZXPFE-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|