C15H13N3O5 — CID 157439553
4-[5-nitro-4-oxo-2-(trideuteriomethyl)quinazolin-3-yl]cyclohexane-1,3-dione (PubChem CID 157439553) has the molecular formula C15H13N3O5 and a molecular weight of 318.30 g/mol. Its IUPAC name is 4-[5-nitro-4-oxo-2-(trideuteriomethyl)quinazolin-3-yl]cyclohexane-1,3-dione.
| Compound Name | 4-[5-nitro-4-oxo-2-(trideuteriomethyl)quinazolin-3-yl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 157439553 |
| Molecular Formula | C15H13N3O5 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 4-[5-nitro-4-oxo-2-(trideuteriomethyl)quinazolin-3-yl]cyclohexane-1,3-dione |
| SMILES | [2H]C([2H])([2H])c1nc2cccc([N+](=O)[O-])c2c(=O)n1C1CCC(=O)CC1=O |
| InChI | InChI=1S/C15H13N3O5/c1-8-16-10-3-2-4-12(18(22)23)14(10)15(21)17(8)11-6-5-9(19)7-13(11)20/h2-4,11H,5-7H2,1H3/i1D3 |
| InChIKey | QHXXOQWYQMBCDY-FIBGUPNXSA-N |
| XLogP | 1.48 |
| TPSA | 112.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|