C14H12N4O8 — CID 144586036
3,4,5-trihydroxy-3-(2-methyl-5-nitro-4-oxoquinazolin-3-yl)piperidine-2,6-dione (PubChem CID 144586036) has the molecular formula C14H12N4O8 and a molecular weight of 364.27 g/mol. Its IUPAC name is 3,4,5-trihydroxy-3-(2-methyl-5-nitro-4-oxoquinazolin-3-yl)piperidine-2,6-dione.
| Compound Name | 3,4,5-trihydroxy-3-(2-methyl-5-nitro-4-oxoquinazolin-3-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 144586036 |
| Molecular Formula | C14H12N4O8 |
| Molecular Weight | 364.27 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 3,4,5-trihydroxy-3-(2-methyl-5-nitro-4-oxoquinazolin-3-yl)piperidine-2,6-dione |
| SMILES | Cc1nc2cccc([N+](=O)[O-])c2c(=O)n1C1(O)C(=O)NC(=O)C(O)C1O |
| InChI | InChI=1S/C14H12N4O8/c1-5-15-6-3-2-4-7(18(25)26)8(6)12(22)17(5)14(24)10(20)9(19)11(21)16-13(14)23/h2-4,9-10,19-20,24H,1H3,(H,16,21,23) |
| InChIKey | LNQNVOXYOUJNNB-UHFFFAOYSA-N |
| XLogP | -2.36 |
| TPSA | 184.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.27 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|