C15H16N4O6 — CID 140856412
methyl (4S)-5-amino-2,2,3,3,4-pentadeuterio-4-(2-methyl-5-nitro-4-oxoquinazolin-3-yl)-5-oxopentanoate (PubChem CID 140856412) has the molecular formula C15H16N4O6 and a molecular weight of 353.35 g/mol. Its IUPAC name is methyl (4S)-5-amino-2,2,3,3,4-pentadeuterio-4-(2-methyl-5-nitro-4-oxoquinazolin-3-yl)-5-oxopentanoate.
| Compound Name | methyl (4S)-5-amino-2,2,3,3,4-pentadeuterio-4-(2-methyl-5-nitro-4-oxoquinazolin-3-yl)-5-oxopentanoate |
|---|---|
| PubChem CID | 140856412 |
| Molecular Formula | C15H16N4O6 |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | methyl (4S)-5-amino-2,2,3,3,4-pentadeuterio-4-(2-methyl-5-nitro-4-oxoquinazolin-3-yl)-5-oxopentanoate |
| SMILES | [2H]C([2H])(C(=O)OC)C([2H])([2H])[C@@]([2H])(C(N)=O)n1c(C)nc2cccc([N+](=O)[O-])c2c1=O |
| InChI | InChI=1S/C15H16N4O6/c1-8-17-9-4-3-5-10(19(23)24)13(9)15(22)18(8)11(14(16)21)6-7-12(20)25-2/h3-5,11H,6-7H2,1-2H3,(H2,16,21)/t11-/m0/s1/i6D2,7D2,11D |
| InChIKey | DYOMEXJYASUGCP-FOKSHZCJSA-N |
| XLogP | 0.59 |
| TPSA | 147.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|