C15H12N2O7S — CID 11516092
ethyl 2-(9-nitro-1,3,3-trioxobenzo[e][1,2]benzothiazol-2-yl)acetate (PubChem CID 11516092) has the molecular formula C15H12N2O7S and a molecular weight of 364.34 g/mol. Its IUPAC name is ethyl 2-(9-nitro-1,3,3-trioxobenzo[e][1,2]benzothiazol-2-yl)acetate.
| Compound Name | ethyl 2-(9-nitro-1,3,3-trioxobenzo[e][1,2]benzothiazol-2-yl)acetate |
|---|---|
| PubChem CID | 11516092 |
| Molecular Formula | C15H12N2O7S |
| Molecular Weight | 364.34 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | ethyl 2-(9-nitro-1,3,3-trioxobenzo[e][1,2]benzothiazol-2-yl)acetate |
| SMILES | CCOC(=O)CN1C(=O)c2c(ccc3cccc([N+](=O)[O-])c23)S1(=O)=O |
| InChI | InChI=1S/C15H12N2O7S/c1-2-24-12(18)8-16-15(19)14-11(25(16,22)23)7-6-9-4-3-5-10(13(9)14)17(20)21/h3-7H,2,8H2,1H3 |
| InChIKey | MHVLGAWRILVIEW-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.34 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|