C21H26N2O5S — CID 8520403
butyl 2-[6-(diethylsulfamoyl)-2-oxobenzo[cd]indol-1-yl]acetate (PubChem CID 8520403) has the molecular formula C21H26N2O5S and a molecular weight of 418.52 g/mol. Its IUPAC name is butyl 2-[6-(diethylsulfamoyl)-2-oxobenzo[cd]indol-1-yl]acetate.
| Compound Name | butyl 2-[6-(diethylsulfamoyl)-2-oxobenzo[cd]indol-1-yl]acetate |
|---|---|
| PubChem CID | 8520403 |
| Molecular Formula | C21H26N2O5S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | butyl 2-[6-(diethylsulfamoyl)-2-oxobenzo[cd]indol-1-yl]acetate |
| SMILES | CCCCOC(=O)CN1C(=O)c2cccc3c(S(=O)(=O)N(CC)CC)ccc1c23 |
| InChI | InChI=1S/C21H26N2O5S/c1-4-7-13-28-19(24)14-23-17-11-12-18(29(26,27)22(5-2)6-3)15-9-8-10-16(20(15)17)21(23)25/h8-12H,4-7,13-14H2,1-3H3 |
| InChIKey | JUVUUYWOAMAEPW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|