C30H33N3O7S — CID 3903114
3-(6-morpholin-4-yl-1,3-dioxobenzo[de]isoquinolin-2-yl)propyl 4-(diethylsulfamoyl)benzoate (PubChem CID 3903114) has the molecular formula C30H33N3O7S and a molecular weight of 579.68 g/mol. Its IUPAC name is 3-(6-morpholin-4-yl-1,3-dioxobenzo[de]isoquinolin-2-yl)propyl 4-(diethylsulfamoyl)benzoate.
| Compound Name | 3-(6-morpholin-4-yl-1,3-dioxobenzo[de]isoquinolin-2-yl)propyl 4-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 3903114 |
| Molecular Formula | C30H33N3O7S |
| Molecular Weight | 579.68 g/mol |
| Exact Mass | 579.20 |
| IUPAC Name | 3-(6-morpholin-4-yl-1,3-dioxobenzo[de]isoquinolin-2-yl)propyl 4-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)OCCCN2C(=O)c3cccc4c(N5CCOCC5)ccc(c34)C2=O)cc1 |
| InChI | InChI=1S/C30H33N3O7S/c1-3-32(4-2)41(37,38)22-11-9-21(10-12-22)30(36)40-18-6-15-33-28(34)24-8-5-7-23-26(31-16-19-39-20-17-31)14-13-25(27(23)24)29(33)35/h5,7-14H,3-4,6,15-20H2,1-2H3 |
| InChIKey | MNGFCVGYSDISTA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 113.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.68 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|