C26H22N4O9 — CID 6737605
3-(6-morpholin-4-yl-1,3-dioxobenzo[de]isoquinolin-2-yl)propyl 3,5-dinitrobenzoate (PubChem CID 6737605) has the molecular formula C26H22N4O9 and a molecular weight of 534.48 g/mol. Its IUPAC name is 3-(6-morpholin-4-yl-1,3-dioxobenzo[de]isoquinolin-2-yl)propyl 3,5-dinitrobenzoate.
| Compound Name | 3-(6-morpholin-4-yl-1,3-dioxobenzo[de]isoquinolin-2-yl)propyl 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 6737605 |
| Molecular Formula | C26H22N4O9 |
| Molecular Weight | 534.48 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | 3-(6-morpholin-4-yl-1,3-dioxobenzo[de]isoquinolin-2-yl)propyl 3,5-dinitrobenzoate |
| SMILES | O=C(OCCCN1C(=O)c2cccc3c(N4CCOCC4)ccc(c23)C1=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H22N4O9/c31-24-20-4-1-3-19-22(27-8-11-38-12-9-27)6-5-21(23(19)20)25(32)28(24)7-2-10-39-26(33)16-13-17(29(34)35)15-18(14-16)30(36)37/h1,3-6,13-15H,2,7-12H2 |
| InChIKey | YHCCFYXJUABXJD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 162.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|