C32H28N2O5 — CID 5194188
3-(6-morpholin-4-yl-1,3-dioxobenzo[de]isoquinolin-2-yl)propyl 4-phenylbenzoate (PubChem CID 5194188) has the molecular formula C32H28N2O5 and a molecular weight of 520.59 g/mol. Its IUPAC name is 3-(6-morpholin-4-yl-1,3-dioxobenzo[de]isoquinolin-2-yl)propyl 4-phenylbenzoate.
| Compound Name | 3-(6-morpholin-4-yl-1,3-dioxobenzo[de]isoquinolin-2-yl)propyl 4-phenylbenzoate |
|---|---|
| PubChem CID | 5194188 |
| Molecular Formula | C32H28N2O5 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | 3-(6-morpholin-4-yl-1,3-dioxobenzo[de]isoquinolin-2-yl)propyl 4-phenylbenzoate |
| SMILES | O=C(OCCCN1C(=O)c2cccc3c(N4CCOCC4)ccc(c23)C1=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C32H28N2O5/c35-30-26-9-4-8-25-28(33-17-20-38-21-18-33)15-14-27(29(25)26)31(36)34(30)16-5-19-39-32(37)24-12-10-23(11-13-24)22-6-2-1-3-7-22/h1-4,6-15H,5,16-21H2 |
| InChIKey | UWDHRDVTRLVENL-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|