C24H17N3O5 — CID 3941057
2-(1,3-dioxoisoindol-2-yl)-6-morpholin-4-ylbenzo[de]isoquinoline-1,3-dione (PubChem CID 3941057) has the molecular formula C24H17N3O5 and a molecular weight of 427.42 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-6-morpholin-4-ylbenzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-6-morpholin-4-ylbenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 3941057 |
| Molecular Formula | C24H17N3O5 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-6-morpholin-4-ylbenzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1N1C(=O)c2cccc3c(N4CCOCC4)ccc(c23)C1=O |
| InChI | InChI=1S/C24H17N3O5/c28-21-14-4-1-2-5-15(14)22(29)26(21)27-23(30)17-7-3-6-16-19(25-10-12-32-13-11-25)9-8-18(20(16)17)24(27)31/h1-9H,10-13H2 |
| InChIKey | UMFVGIRPHPEBTA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|