C33H39N3O6S — CID 3594229
3-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)propyl 4-(dipropylsulfamoyl)benzoate (PubChem CID 3594229) has the molecular formula C33H39N3O6S and a molecular weight of 605.76 g/mol. Its IUPAC name is 3-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)propyl 4-(dipropylsulfamoyl)benzoate.
| Compound Name | 3-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)propyl 4-(dipropylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 3594229 |
| Molecular Formula | C33H39N3O6S |
| Molecular Weight | 605.76 g/mol |
| Exact Mass | 605.26 |
| IUPAC Name | 3-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)propyl 4-(dipropylsulfamoyl)benzoate |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(C(=O)OCCCN2C(=O)c3cccc4c(N5CCCCC5)ccc(c34)C2=O)cc1 |
| InChI | InChI=1S/C33H39N3O6S/c1-3-18-35(19-4-2)43(40,41)25-14-12-24(13-15-25)33(39)42-23-9-22-36-31(37)27-11-8-10-26-29(34-20-6-5-7-21-34)17-16-28(30(26)27)32(36)38/h8,10-17H,3-7,9,18-23H2,1-2H3 |
| InChIKey | RDZOPGMIBVTGSW-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 104.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.76 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|