C20H25N3O5S — CID 8520385
2-[6-(diethylsulfamoyl)-2-oxobenzo[cd]indol-1-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 8520385) has the molecular formula C20H25N3O5S and a molecular weight of 419.50 g/mol. Its IUPAC name is 2-[6-(diethylsulfamoyl)-2-oxobenzo[cd]indol-1-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[6-(diethylsulfamoyl)-2-oxobenzo[cd]indol-1-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 8520385 |
| Molecular Formula | C20H25N3O5S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 2-[6-(diethylsulfamoyl)-2-oxobenzo[cd]indol-1-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c3c(cccc13)C(=O)N2CC(=O)NCCOC |
| InChI | InChI=1S/C20H25N3O5S/c1-4-22(5-2)29(26,27)17-10-9-16-19-14(17)7-6-8-15(19)20(25)23(16)13-18(24)21-11-12-28-3/h6-10H,4-5,11-13H2,1-3H3,(H,21,24) |
| InChIKey | BFUSNQVEUNAOFG-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|